C26H35F4N3 — CID 71193221
(2S,3R,4S)-2-(4-fluorocyclohexa-2,4-dien-1-yl)-4-methyl-3-[(3R)-3-methyl-4-piperazin-1-ylbutyl]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 71193221) has the molecular formula C26H35F4N3 and a molecular weight of 465.58 g/mol. Its IUPAC name is (2S,3R,4S)-2-(4-fluorocyclohexa-2,4-dien-1-yl)-4-methyl-3-[(3R)-3-methyl-4-piperazin-1-ylbutyl]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,3R,4S)-2-(4-fluorocyclohexa-2,4-dien-1-yl)-4-methyl-3-[(3R)-3-methyl-4-piperazin-1-ylbutyl]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 71193221 |
| Molecular Formula | C26H35F4N3 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | (2S,3R,4S)-2-(4-fluorocyclohexa-2,4-dien-1-yl)-4-methyl-3-[(3R)-3-methyl-4-piperazin-1-ylbutyl]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@H](CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1C1C=CC(F)=CC1)CN1CCNCC1 |
| InChI | InChI=1S/C26H35F4N3/c1-17(16-33-13-11-31-12-14-33)3-9-22-18(2)23-15-20(26(28,29)30)6-10-24(23)32-25(22)19-4-7-21(27)8-5-19/h4,6-8,10,15,17-19,22,25,31-32H,3,5,9,11-14,16H2,1-2H3/t17-,18+,19?,22-,25+/m1/s1 |
| InChIKey | XGCQDOJHZVWXDJ-IPIWHIMDSA-N |
| XLogP | 5.97 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |