C24H31F3N2O2S — CID 89358238
N-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]ethenesulfonamide (PubChem CID 89358238) has the molecular formula C24H31F3N2O2S and a molecular weight of 468.59 g/mol. Its IUPAC name is N-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]ethenesulfonamide.
| Compound Name | N-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]ethenesulfonamide |
|---|---|
| PubChem CID | 89358238 |
| Molecular Formula | C24H31F3N2O2S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H](C)CC[C@@H]1C(C)c2cc(C(F)(F)F)ccc2N[C@H]1C1C=CC=CC1 |
| InChI | InChI=1S/C24H31F3N2O2S/c1-4-32(30,31)28-15-16(2)10-12-20-17(3)21-14-19(24(25,26)27)11-13-22(21)29-23(20)18-8-6-5-7-9-18/h4-8,11,13-14,16-18,20,23,28-29H,1,9-10,12,15H2,2-3H3/t16-,17?,18?,20-,23+/m1/s1 |
| InChIKey | LEGLEHWYLJLQKD-BXAKRXIUSA-N |
| XLogP | 5.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |