C26H35F3N2O — CID 71193222
(3R)-1-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]pyrrolidin-3-ol (PubChem CID 71193222) has the molecular formula C26H35F3N2O and a molecular weight of 448.57 g/mol. Its IUPAC name is (3R)-1-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 71193222 |
| Molecular Formula | C26H35F3N2O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (3R)-1-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]pyrrolidin-3-ol |
| SMILES | C[C@H](CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1C1C=CC=CC1)CN1CC[C@@H](O)C1 |
| InChI | InChI=1S/C26H35F3N2O/c1-17(15-31-13-12-21(32)16-31)8-10-22-18(2)23-14-20(26(27,28)29)9-11-24(23)30-25(22)19-6-4-3-5-7-19/h3-6,9,11,14,17-19,21-22,25,30,32H,7-8,10,12-13,15-16H2,1-2H3/t17-,18+,19?,21-,22-,25+/m1/s1 |
| InChIKey | POPNQWVHZLMUPQ-IGCRIXPASA-N |
| XLogP | 5.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |