C29H40F3N3O2 — CID 71027729
ethyl 4-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]piperazine-1-carboxylate (PubChem CID 71027729) has the molecular formula C29H40F3N3O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is ethyl 4-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71027729 |
| Molecular Formula | C29H40F3N3O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | ethyl 4-[(2R)-4-[(2S,3R)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C[C@H](C)CC[C@@H]2C(C)c3cc(C(F)(F)F)ccc3N[C@H]2C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C29H40F3N3O2/c1-4-37-28(36)35-16-14-34(15-17-35)19-20(2)10-12-24-21(3)25-18-23(29(30,31)32)11-13-26(25)33-27(24)22-8-6-5-7-9-22/h5-8,11,13,18,20-22,24,27,33H,4,9-10,12,14-17,19H2,1-3H3/t20-,21?,22?,24-,27+/m1/s1 |
| InChIKey | WCPDRRISCPACEC-TZLONQIGSA-N |
| XLogP | 6.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |