C26H32F3N3O2 — CID 59448601
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h]chromen-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea (PubChem CID 59448601) has the molecular formula C26H32F3N3O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h]chromen-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h]chromen-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 59448601 |
| Molecular Formula | C26H32F3N3O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h]chromen-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea |
| SMILES | CN(C)CCNC(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H32F3N3O2/c1-32(2)13-12-30-25(33)31-16-20-10-11-21-22(17-6-4-3-5-7-17)14-18-8-9-19(26(27,28)29)15-23(18)24(21)34-20/h3-9,15,20-22,24H,10-14,16H2,1-2H3,(H2,30,31,33)/t20-,21+,22+,24+/m1/s1 |
| InChIKey | ZZUQZACKJZYWDU-VCHRRKICSA-N |
| XLogP | 4.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |