C27H27F3N2O — CID 162583122
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-cyclopropa-1,2-dien-1-ylbut-3-en-1-amine (PubChem CID 162583122) has the molecular formula C27H27F3N2O and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-cyclopropa-1,2-dien-1-ylbut-3-en-1-amine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-cyclopropa-1,2-dien-1-ylbut-3-en-1-amine |
|---|---|
| PubChem CID | 162583122 |
| Molecular Formula | C27H27F3N2O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-cyclopropa-1,2-dien-1-ylbut-3-en-1-amine |
| SMILES | C=CC(CNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C1=C=C1 |
| InChI | InChI=1S/C27H27F3N2O/c1-2-17(18-8-9-18)15-31-16-21-11-12-22-25(19-6-4-3-5-7-19)32-24-13-10-20(27(28,29)30)14-23(24)26(22)33-21/h2-8,10,13-14,17,21-22,25-26,31-32H,1,11-12,15-16H2/t17?,21-,22+,25+,26+/m1/s1 |
| InChIKey | ACTPYDNZFVUVEH-MVRBYJIXSA-N |
| XLogP | 6.20 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|