C27H32F3N3O2 — CID 58956502
1-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 58956502) has the molecular formula C27H32F3N3O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 1-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58956502 |
| Molecular Formula | C27H32F3N3O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 1-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H32F3N3O2/c28-27(29,30)19-9-12-23-22(16-19)26-21(25(32-23)18-6-2-1-3-7-18)11-10-20(35-26)17-31-13-5-15-33-14-4-8-24(33)34/h1-3,6-7,9,12,16,20-21,25-26,31-32H,4-5,8,10-11,13-15,17H2/t20-,21+,25+,26+/m1/s1 |
| InChIKey | JOSBHAAUAWOQIX-SYUUKGODSA-N |
| XLogP | 5.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|