C29H32F3N3O3S — CID 58956803
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzenesulfonamide (PubChem CID 58956803) has the molecular formula C29H32F3N3O3S and a molecular weight of 559.65 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58956803 |
| Molecular Formula | C29H32F3N3O3S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCN)C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32F3N3O3S/c1-19-7-11-23(12-8-19)39(36,37)35(16-15-33)18-22-10-13-24-27(20-5-3-2-4-6-20)34-26-14-9-21(29(30,31)32)17-25(26)28(24)38-22/h2-9,11-12,14,17,22,24,27-28,34H,10,13,15-16,18,33H2,1H3/t22-,24+,27+,28+/m1/s1 |
| InChIKey | DHAGTCCZYWNXOA-OEZPAIJMSA-N |
| XLogP | 5.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |