C23H27F3N2O5S2 — CID 143454475
N-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 143454475) has the molecular formula C23H27F3N2O5S2 and a molecular weight of 532.61 g/mol. Its IUPAC name is N-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 143454475 |
| Molecular Formula | C23H27F3N2O5S2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](CO1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H27F3N2O5S2/c1-34(29,30)14-35(31,32)27-12-17-8-9-18-20(13-33-17)19-11-16(23(24,25)26)7-10-21(19)28-22(18)15-5-3-2-4-6-15/h2-7,10-11,17-18,20,22,27-28H,8-9,12-14H2,1H3/t17-,18-,20+,22+/m1/s1 |
| InChIKey | BJVYDASNJSFNEN-VFSLUADLSA-N |
| XLogP | 3.67 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |