C24H20ClF9N2O3 — CID 174431576
2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-carbonochloridoylamino]-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate (PubChem CID 174431576) has the molecular formula C24H20ClF9N2O3 and a molecular weight of 590.87 g/mol. Its IUPAC name is 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-carbonochloridoylamino]-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate.
| Compound Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-carbonochloridoylamino]-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate |
|---|---|
| PubChem CID | 174431576 |
| Molecular Formula | C24H20ClF9N2O3 |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl-carbonochloridoylamino]-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate |
| SMILES | CC(COC=O)N1CCC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)Cl)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H20ClF9N2O3/c1-13(11-39-12-37)35-5-4-20(18-9-15(22(26,27)28)2-3-19(18)35)36(21(25)38)10-14-6-16(23(29,30)31)8-17(7-14)24(32,33)34/h2-3,6-9,12-13,20H,4-5,10-11H2,1H3 |
| InChIKey | XGZYRXGQDKYVNM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|