C27H30F6N2O3 — CID 59003160
propan-2-yl 5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate (PubChem CID 59003160) has the molecular formula C27H30F6N2O3 and a molecular weight of 544.54 g/mol. Its IUPAC name is propan-2-yl 5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate.
| Compound Name | propan-2-yl 5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 59003160 |
| Molecular Formula | C27H30F6N2O3 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | propan-2-yl 5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
| SMILES | CC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCN(C(=O)OC(C)C)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C27H30F6N2O3/c1-15(2)38-25(37)34-8-6-7-23(22-9-16(3)17(4)10-24(22)34)35(18(5)36)14-19-11-20(26(28,29)30)13-21(12-19)27(31,32)33/h9-13,15,23H,6-8,14H2,1-5H3 |
| InChIKey | PZABXENEQXNQHH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |