C24H25F6N3O4 — CID 87726106
[5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl] propan-2-yl carbonate (PubChem CID 87726106) has the molecular formula C24H25F6N3O4 and a molecular weight of 533.47 g/mol. Its IUPAC name is [5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl] propan-2-yl carbonate.
| Compound Name | [5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 87726106 |
| Molecular Formula | C24H25F6N3O4 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [5-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl] propan-2-yl carbonate |
| SMILES | CC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCN(OC(=O)OC(C)C)c2cnccc21 |
| InChI | InChI=1S/C24H25F6N3O4/c1-14(2)36-22(35)37-33-8-4-5-20(19-6-7-31-12-21(19)33)32(15(3)34)13-16-9-17(23(25,26)27)11-18(10-16)24(28,29)30/h6-7,9-12,14,20H,4-5,8,13H2,1-3H3 |
| InChIKey | LUZUSKHOFAAKFL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |