C24H24BrF6N3O4 — CID 87726140
[9-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl] propan-2-yl carbonate (PubChem CID 87726140) has the molecular formula C24H24BrF6N3O4 and a molecular weight of 612.37 g/mol. Its IUPAC name is [9-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl] propan-2-yl carbonate.
| Compound Name | [9-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 87726140 |
| Molecular Formula | C24H24BrF6N3O4 |
| Molecular Weight | 612.37 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | [9-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl] propan-2-yl carbonate |
| SMILES | CC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCN(OC(=O)OC(C)C)c2ccc(Br)nc21 |
| InChI | InChI=1S/C24H24BrF6N3O4/c1-13(2)37-22(36)38-34-8-4-5-18(21-19(34)6-7-20(25)32-21)33(14(3)35)12-15-9-16(23(26,27)28)11-17(10-15)24(29,30)31/h6-7,9-11,13,18H,4-5,8,12H2,1-3H3 |
| InChIKey | MQICVUOGWTUUHB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|