C23H23BrF6N2O4S — CID 87725917
[8-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl] propan-2-yl carbonate (PubChem CID 87725917) has the molecular formula C23H23BrF6N2O4S and a molecular weight of 617.41 g/mol. Its IUPAC name is [8-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl] propan-2-yl carbonate.
| Compound Name | [8-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 87725917 |
| Molecular Formula | C23H23BrF6N2O4S |
| Molecular Weight | 617.41 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | [8-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-bromo-5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl] propan-2-yl carbonate |
| SMILES | CC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCN(OC(=O)OC(C)C)c2cc(Br)sc21 |
| InChI | InChI=1S/C23H23BrF6N2O4S/c1-12(2)35-21(34)36-32-6-4-5-17(20-18(32)10-19(24)37-20)31(13(3)33)11-14-7-15(22(25,26)27)9-16(8-14)23(28,29)30/h7-10,12,17H,4-6,11H2,1-3H3 |
| InChIKey | LFTXVRFDEQFTID-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.41 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |