C24H28F6N2O3S — CID 89345215
propan-2-yl 7-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-5-ethyl-3,5,6,7-tetrahydro-2H-thieno[3,2-b]pyridine-4-carboxylate (PubChem CID 89345215) has the molecular formula C24H28F6N2O3S and a molecular weight of 538.55 g/mol. Its IUPAC name is propan-2-yl 7-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-5-ethyl-3,5,6,7-tetrahydro-2H-thieno[3,2-b]pyridine-4-carboxylate.
| Compound Name | propan-2-yl 7-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-5-ethyl-3,5,6,7-tetrahydro-2H-thieno[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 89345215 |
| Molecular Formula | C24H28F6N2O3S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | propan-2-yl 7-[acetyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-5-ethyl-3,5,6,7-tetrahydro-2H-thieno[3,2-b]pyridine-4-carboxylate |
| SMILES | CCC1CC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(C)=O)C2=C(CCS2)N1C(=O)OC(C)C |
| InChI | InChI=1S/C24H28F6N2O3S/c1-5-18-11-20(21-19(6-7-36-21)32(18)22(34)35-13(2)3)31(14(4)33)12-15-8-16(23(25,26)27)10-17(9-15)24(28,29)30/h8-10,13,18,20H,5-7,11-12H2,1-4H3 |
| InChIKey | QLVILEBMYFMYBH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |