C28H30F6N6O2 — CID 11599660
propan-2-yl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate (PubChem CID 11599660) has the molecular formula C28H30F6N6O2 and a molecular weight of 596.58 g/mol. Its IUPAC name is propan-2-yl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate.
| Compound Name | propan-2-yl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 11599660 |
| Molecular Formula | C28H30F6N6O2 |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | propan-2-yl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCCC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nnn(C)n2)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C28H30F6N6O2/c1-16(2)42-26(41)39-9-5-8-23(22-12-18-6-4-7-19(18)13-24(22)39)40(25-35-37-38(3)36-25)15-17-10-20(27(29,30)31)14-21(11-17)28(32,33)34/h10-14,16,23H,4-9,15H2,1-3H3 |
| InChIKey | DVPOEQYHIZNFLH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |