C24H23F6N6O2- — CID 154071561
(5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-8,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate (PubChem CID 154071561) has the molecular formula C24H23F6N6O2- and a molecular weight of 541.48 g/mol. Its IUPAC name is (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-8,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate.
| Compound Name | (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-8,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 154071561 |
| Molecular Formula | C24H23F6N6O2- |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-8,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
| SMILES | Cc1ccc2c(c1C)N(C(=O)[O-])CCC[C@@H]2N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nnn(C)n1 |
| InChI | InChI=1S/C24H24F6N6O2/c1-13-6-7-18-19(5-4-8-35(22(37)38)20(18)14(13)2)36(21-31-33-34(3)32-21)12-15-9-16(23(25,26)27)11-17(10-15)24(28,29)30/h6-7,9-11,19H,4-5,8,12H2,1-3H3,(H,37,38)/p-1/t19-/m0/s1 |
| InChIKey | NLQZXYODYSOKSG-IBGZPJMESA-M |
| XLogP | 4.56 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |