C29H34F6N6O2 — CID 59432397
3-methylbutan-2-yl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate (PubChem CID 59432397) has the molecular formula C29H34F6N6O2 and a molecular weight of 612.62 g/mol. Its IUPAC name is 3-methylbutan-2-yl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate.
| Compound Name | 3-methylbutan-2-yl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 59432397 |
| Molecular Formula | C29H34F6N6O2 |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 3-methylbutan-2-yl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
| SMILES | Cc1cc2c(cc1C)N(C(=O)OC(C)C(C)C)CCC[C@@H]2N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nnn(C)n1 |
| InChI | InChI=1S/C29H34F6N6O2/c1-16(2)19(5)43-27(42)40-9-7-8-24(23-10-17(3)18(4)11-25(23)40)41(26-36-38-39(6)37-26)15-20-12-21(28(30,31)32)14-22(13-20)29(33,34)35/h10-14,16,19,24H,7-9,15H2,1-6H3/t19?,24-/m0/s1 |
| InChIKey | MKCMQPVLSJBTCZ-WIIYFNMSSA-N |
| XLogP | 7.39 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |