C31H36F6N6O2 — CID 135377089
[(5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methyl cyclohexanecarboxylate (PubChem CID 135377089) has the molecular formula C31H36F6N6O2 and a molecular weight of 638.66 g/mol. Its IUPAC name is [(5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methyl cyclohexanecarboxylate.
| Compound Name | [(5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 135377089 |
| Molecular Formula | C31H36F6N6O2 |
| Molecular Weight | 638.66 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | [(5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methyl cyclohexanecarboxylate |
| SMILES | Cc1cc(C)c2c(c1)[C@@H](N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nnn(C)n1)CCCN2COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C31H36F6N6O2/c1-19-12-20(2)27-25(13-19)26(10-7-11-42(27)18-45-28(44)22-8-5-4-6-9-22)43(29-38-40-41(3)39-29)17-21-14-23(30(32,33)34)16-24(15-21)31(35,36)37/h12-16,22,26H,4-11,17-18H2,1-3H3/t26-/m0/s1 |
| InChIKey | CYNSHKDYXMJRRB-SANMLTNESA-N |
| XLogP | 7.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |