C29H35F6N7 — CID 123434600
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7,9-dimethyl-N-(2-methyltetrazol-5-yl)-1-(piperidin-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 123434600) has the molecular formula C29H35F6N7 and a molecular weight of 595.64 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7,9-dimethyl-N-(2-methyltetrazol-5-yl)-1-(piperidin-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7,9-dimethyl-N-(2-methyltetrazol-5-yl)-1-(piperidin-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 123434600 |
| Molecular Formula | C29H35F6N7 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7,9-dimethyl-N-(2-methyltetrazol-5-yl)-1-(piperidin-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | Cc1cc(C)c2c(c1)C(N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nnn(C)n1)CCCN2CC1CCNCC1 |
| InChI | InChI=1S/C29H35F6N7/c1-18-11-19(2)26-24(12-18)25(5-4-10-41(26)16-20-6-8-36-9-7-20)42(27-37-39-40(3)38-27)17-21-13-22(28(30,31)32)15-23(14-21)29(33,34)35/h11-15,20,25,36H,4-10,16-17H2,1-3H3 |
| InChIKey | PVXCOFFKJHMVPH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |