C24H26F6N6O2 — CID 87177861
5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5,6,7-hexahydro-1-benzazepine-1-carboxylic acid (PubChem CID 87177861) has the molecular formula C24H26F6N6O2 and a molecular weight of 544.50 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5,6,7-hexahydro-1-benzazepine-1-carboxylic acid.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5,6,7-hexahydro-1-benzazepine-1-carboxylic acid |
|---|---|
| PubChem CID | 87177861 |
| Molecular Formula | C24H26F6N6O2 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2-methyltetrazol-5-yl)amino]-7,9-dimethyl-2,3,4,5,6,7-hexahydro-1-benzazepine-1-carboxylic acid |
| SMILES | CC1=CC(C)CC2=C1N(C(=O)O)CCCC2N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nnn(C)n1 |
| InChI | InChI=1S/C24H26F6N6O2/c1-13-7-14(2)20-18(8-13)19(5-4-6-35(20)22(37)38)36(21-31-33-34(3)32-21)12-15-9-16(23(25,26)27)11-17(10-15)24(28,29)30/h7,9-11,13,19H,4-6,8,12H2,1-3H3,(H,37,38) |
| InChIKey | DBBDFCHQOVWTSL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |