C28H30F6N6O2 — CID 87393682
tert-butyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate (PubChem CID 87393682) has the molecular formula C28H30F6N6O2 and a molecular weight of 596.58 g/mol. Its IUPAC name is tert-butyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate.
| Compound Name | tert-butyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 87393682 |
| Molecular Formula | C28H30F6N6O2 |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | tert-butyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nn[nH]n2)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C28H30F6N6O2/c1-26(2,3)42-25(41)39-9-5-8-22(21-12-17-6-4-7-18(17)13-23(21)39)40(24-35-37-38-36-24)15-16-10-19(27(29,30)31)14-20(11-16)28(32,33)34/h10-14,22H,4-9,15H2,1-3H3,(H,35,36,37,38) |
| InChIKey | VHHGFFRQUPACMU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |