C29H32F6N6O2 — CID 162581688
cyclopentyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,5-dihydro-1H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate (PubChem CID 162581688) has the molecular formula C29H32F6N6O2 and a molecular weight of 610.60 g/mol. Its IUPAC name is cyclopentyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,5-dihydro-1H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate.
| Compound Name | cyclopentyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,5-dihydro-1H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 162581688 |
| Molecular Formula | C29H32F6N6O2 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | cyclopentyl 5-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,5-dihydro-1H-tetrazol-5-yl)amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
| SMILES | O=C(OC1CCCC1)N1CCCC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C2N=NNN2)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C29H32F6N6O2/c30-28(31,32)20-11-17(12-21(15-20)29(33,34)35)16-41(26-36-38-39-37-26)24-9-4-10-40(27(42)43-22-7-1-2-8-22)25-14-19-6-3-5-18(19)13-23(24)25/h11-15,22,24,26H,1-10,16H2,(H,36,39)(H,37,38) |
| InChIKey | ZMUZZXMFZKJIRK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |