C27H28F6N2O3S — CID 57022744
ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methylsulfanylcarbonylamino]-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylate (PubChem CID 57022744) has the molecular formula C27H28F6N2O3S and a molecular weight of 574.59 g/mol. Its IUPAC name is ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methylsulfanylcarbonylamino]-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylate.
| Compound Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methylsulfanylcarbonylamino]-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 57022744 |
| Molecular Formula | C27H28F6N2O3S |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methylsulfanylcarbonylamino]-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc3c(cc2C(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)SC)CC1C)CCC3 |
| InChI | InChI=1S/C27H28F6N2O3S/c1-4-38-24(36)35-15(2)8-22(21-11-17-6-5-7-18(17)12-23(21)35)34(25(37)39-3)14-16-9-19(26(28,29)30)13-20(10-16)27(31,32)33/h9-13,15,22H,4-8,14H2,1-3H3 |
| InChIKey | IJEJMZYPSFQERF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|