C26H25F9N2O5 — CID 54250439
ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 54250439) has the molecular formula C26H25F9N2O5 and a molecular weight of 616.48 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 54250439 |
| Molecular Formula | C26H25F9N2O5 |
| Molecular Weight | 616.48 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(OC)c(OC)cc2[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)C(F)(F)F)C[C@H]1C |
| InChI | InChI=1S/C26H25F9N2O5/c1-5-42-23(39)37-13(2)6-18(17-10-20(40-3)21(41-4)11-19(17)37)36(22(38)26(33,34)35)12-14-7-15(24(27,28)29)9-16(8-14)25(30,31)32/h7-11,13,18H,5-6,12H2,1-4H3/t13-,18+/m1/s1 |
| InChIKey | QWIYLGIKGGZCJK-ACJLOTCBSA-N |
| XLogP | 7.13 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.48 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |