C30H34F6N2O8 — CID 87953001
2-O-butyl 1-O-ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-6,7-dimethoxy-3,4-dihydro-2H-quinoline-1,2-dicarboxylate (PubChem CID 87953001) has the molecular formula C30H34F6N2O8 and a molecular weight of 664.60 g/mol. Its IUPAC name is 2-O-butyl 1-O-ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-6,7-dimethoxy-3,4-dihydro-2H-quinoline-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-6,7-dimethoxy-3,4-dihydro-2H-quinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87953001 |
| Molecular Formula | C30H34F6N2O8 |
| Molecular Weight | 664.60 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | 2-O-butyl 1-O-ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-6,7-dimethoxy-3,4-dihydro-2H-quinoline-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1CC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)OC)c2cc(OC)c(OC)cc2N1C(=O)OCC |
| InChI | InChI=1S/C30H34F6N2O8/c1-6-8-9-46-26(39)23-14-21(20-13-24(42-3)25(43-4)15-22(20)38(23)28(41)45-7-2)37(27(40)44-5)16-17-10-18(29(31,32)33)12-19(11-17)30(34,35)36/h10-13,15,21,23H,6-9,14,16H2,1-5H3 |
| InChIKey | RBOZPBXSKSJMBW-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.60 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|