C26H24F6N2O6 — CID 87955661
ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-8-oxo-2,3,4,6-tetrahydrofuro[3,4-g]quinoline-1-carboxylate (PubChem CID 87955661) has the molecular formula C26H24F6N2O6 and a molecular weight of 574.47 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-8-oxo-2,3,4,6-tetrahydrofuro[3,4-g]quinoline-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-8-oxo-2,3,4,6-tetrahydrofuro[3,4-g]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 87955661 |
| Molecular Formula | C26H24F6N2O6 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-8-oxo-2,3,4,6-tetrahydrofuro[3,4-g]quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc3c(cc2[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)OC)C[C@H]1C)COC3=O |
| InChI | InChI=1S/C26H24F6N2O6/c1-4-39-24(37)34-13(2)5-20(19-8-15-12-40-22(35)18(15)10-21(19)34)33(23(36)38-3)11-14-6-16(25(27,28)29)9-17(7-14)26(30,31)32/h6-10,13,20H,4-5,11-12H2,1-3H3/t13-,20+/m1/s1 |
| InChIKey | YMHBAOVTGKRRLA-XCLFUZPHSA-N |
| XLogP | 6.46 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|