C29H34F6N6O2 — CID 162551946
tert-butyl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate (PubChem CID 162551946) has the molecular formula C29H34F6N6O2 and a molecular weight of 612.62 g/mol. Its IUPAC name is tert-butyl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 162551946 |
| Molecular Formula | C29H34F6N6O2 |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | tert-butyl (5S)-5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3,4,5,7,8,9-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
| SMILES | C/N=N/N=C(N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1CCCN(C(=O)OC(C)(C)C)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C29H34F6N6O2/c1-27(2,3)43-26(42)40-10-6-9-23(22-13-18-7-5-8-19(18)14-24(22)40)41(25(36)38-39-37-4)16-17-11-20(28(30,31)32)15-21(12-17)29(33,34)35/h11-15,23H,5-10,16H2,1-4H3,(H2,36,37,38)/t23-/m0/s1 |
| InChIKey | KHJHMTGRCDHXDT-QHCPKHFHSA-N |
| XLogP | 7.60 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|