C26H28F9N5O2 — CID 154548907
propan-2-yl 5-[[(Z)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-9-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate (PubChem CID 154548907) has the molecular formula C26H28F9N5O2 and a molecular weight of 613.53 g/mol. Its IUPAC name is propan-2-yl 5-[[(Z)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-9-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate.
| Compound Name | propan-2-yl 5-[[(Z)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-9-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 154548907 |
| Molecular Formula | C26H28F9N5O2 |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | propan-2-yl 5-[[(Z)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-9-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
| SMILES | Cc1c(C(F)(F)F)ccc2c1N(C(=O)OC(C)C)CCCC2N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N\N |
| InChI | InChI=1S/C26H28F9N5O2/c1-13(2)42-23(41)39-8-4-5-20(18-6-7-19(26(33,34)35)14(3)21(18)39)40(22(36)38-37)12-15-9-16(24(27,28)29)11-17(10-15)25(30,31)32/h6-7,9-11,13,20H,4-5,8,12,37H2,1-3H3,(H2,36,38) |
| InChIKey | XEBYZUWQEGMJQT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|