C26H29F8N6O2P — CID 143119777
propan-2-yl 4-[[(E)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-cyclopropyl-6-[difluoro(phosphanyl)methyl]-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 143119777) has the molecular formula C26H29F8N6O2P and a molecular weight of 640.52 g/mol. Its IUPAC name is propan-2-yl 4-[[(E)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-cyclopropyl-6-[difluoro(phosphanyl)methyl]-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[(E)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-cyclopropyl-6-[difluoro(phosphanyl)methyl]-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 143119777 |
| Molecular Formula | C26H29F8N6O2P |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | propan-2-yl 4-[[(E)-C-aminocarbonohydrazonoyl]-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]-2-cyclopropyl-6-[difluoro(phosphanyl)methyl]-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1c2ccc(C(F)(F)P)nc2C(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(N)=N/N)CC1C1CC1 |
| InChI | InChI=1S/C26H29F8N6O2P/c1-12(2)42-23(41)40-17-5-6-20(26(33,34)43)37-21(17)19(10-18(40)14-3-4-14)39(22(35)38-36)11-13-7-15(24(27,28)29)9-16(8-13)25(30,31)32/h5-9,12,14,18-19H,3-4,10-11,36,43H2,1-2H3,(H2,35,38) |
| InChIKey | IOFIXGJYZSRONF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|