C25H26F6N6 — CID 59432294
(5S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methyltetrazol-5-yl)-2,3,4,5,7,8,9,10-octahydro-1H-benzo[h][1]benzazepin-5-amine (PubChem CID 59432294) has the molecular formula C25H26F6N6 and a molecular weight of 524.51 g/mol. Its IUPAC name is (5S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methyltetrazol-5-yl)-2,3,4,5,7,8,9,10-octahydro-1H-benzo[h][1]benzazepin-5-amine.
| Compound Name | (5S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methyltetrazol-5-yl)-2,3,4,5,7,8,9,10-octahydro-1H-benzo[h][1]benzazepin-5-amine |
|---|---|
| PubChem CID | 59432294 |
| Molecular Formula | C25H26F6N6 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (5S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methyltetrazol-5-yl)-2,3,4,5,7,8,9,10-octahydro-1H-benzo[h][1]benzazepin-5-amine |
| SMILES | Cn1nnc(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H]2CCCNc3cc4c(cc32)CCCC4)n1 |
| InChI | InChI=1S/C25H26F6N6/c1-36-34-23(33-35-36)37(14-15-9-18(24(26,27)28)13-19(10-15)25(29,30)31)22-7-4-8-32-21-12-17-6-3-2-5-16(17)11-20(21)22/h9-13,22,32H,2-8,14H2,1H3/t22-/m0/s1 |
| InChIKey | RDUWEQFLSQLAIM-QFIPXVFZSA-N |
| XLogP | 6.08 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |