C24H24F6N6O2 — CID 59432481
2-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(5S)-2,3,4,5,7,9-hexahydro-1H-furo[3,4-h][1]benzazepin-5-yl]amino]tetrazol-2-yl]ethanol (PubChem CID 59432481) has the molecular formula C24H24F6N6O2 and a molecular weight of 542.48 g/mol. Its IUPAC name is 2-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(5S)-2,3,4,5,7,9-hexahydro-1H-furo[3,4-h][1]benzazepin-5-yl]amino]tetrazol-2-yl]ethanol.
| Compound Name | 2-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(5S)-2,3,4,5,7,9-hexahydro-1H-furo[3,4-h][1]benzazepin-5-yl]amino]tetrazol-2-yl]ethanol |
|---|---|
| PubChem CID | 59432481 |
| Molecular Formula | C24H24F6N6O2 |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(5S)-2,3,4,5,7,9-hexahydro-1H-furo[3,4-h][1]benzazepin-5-yl]amino]tetrazol-2-yl]ethanol |
| SMILES | OCCn1nnc(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H]2CCCNc3cc4c(cc32)COC4)n1 |
| InChI | InChI=1S/C24H24F6N6O2/c25-23(26,27)17-6-14(7-18(10-17)24(28,29)30)11-35(22-32-34-36(33-22)4-5-37)21-2-1-3-31-20-9-16-13-38-12-15(16)8-19(20)21/h6-10,21,31,37H,1-5,11-13H2/t21-/m0/s1 |
| InChIKey | UJBDXTTXHOETOB-NRFANRHFSA-N |
| XLogP | 4.69 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |