C11H12N2O2 — CID 102287114
3-methyl-7-nitro-2,5-dihydro-1H-1-benzazepine (PubChem CID 102287114) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-methyl-7-nitro-2,5-dihydro-1H-1-benzazepine.
| Compound Name | 3-methyl-7-nitro-2,5-dihydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 102287114 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-methyl-7-nitro-2,5-dihydro-1H-1-benzazepine |
| SMILES | CC1=CCc2cc([N+](=O)[O-])ccc2NC1 |
| InChI | InChI=1S/C11H12N2O2/c1-8-2-3-9-6-10(13(14)15)4-5-11(9)12-7-8/h2,4-6,12H,3,7H2,1H3 |
| InChIKey | ULBFQURGLWACSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|