C12H15ClN4O3 — CID 175959201
9-nitro-2,3,4,4a,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepin-5-one;hydrochloride (PubChem CID 175959201) has the molecular formula C12H15ClN4O3 and a molecular weight of 298.73 g/mol. Its IUPAC name is 9-nitro-2,3,4,4a,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepin-5-one;hydrochloride.
| Compound Name | 9-nitro-2,3,4,4a,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepin-5-one;hydrochloride |
|---|---|
| PubChem CID | 175959201 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 9-nitro-2,3,4,4a,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepin-5-one;hydrochloride |
| SMILES | Cl.O=C1NCc2cc([N+](=O)[O-])ccc2N2CCNCC12 |
| InChI | InChI=1S/C12H14N4O3.ClH/c17-12-11-7-13-3-4-15(11)10-2-1-9(16(18)19)5-8(10)6-14-12;/h1-2,5,11,13H,3-4,6-7H2,(H,14,17);1H |
| InChIKey | YTUOXISEGUPWGO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|