C15H15N5O5 — CID 10407501
8-nitrospiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 10407501) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 8-nitrospiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | 8-nitrospiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 10407501 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 8-nitrospiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoline-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | O=C1NC(=O)C2(Cc3cc([N+](=O)[O-])ccc3N3CCNCC32)C(=O)N1 |
| InChI | InChI=1S/C15H15N5O5/c21-12-15(13(22)18-14(23)17-12)6-8-5-9(20(24)25)1-2-10(8)19-4-3-16-7-11(15)19/h1-2,5,11,16H,3-4,6-7H2,(H2,17,18,21,22,23) |
| InChIKey | APMIGGUWSZAMIZ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|