C17H18N4O4S — CID 58228600
(5S)-3-methyl-8-nitro-6'-sulfanylidenespiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,3'-piperidine]-2',4'-dione (PubChem CID 58228600) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is (5S)-3-methyl-8-nitro-6'-sulfanylidenespiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,3'-piperidine]-2',4'-dione.
| Compound Name | (5S)-3-methyl-8-nitro-6'-sulfanylidenespiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,3'-piperidine]-2',4'-dione |
|---|---|
| PubChem CID | 58228600 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (5S)-3-methyl-8-nitro-6'-sulfanylidenespiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,3'-piperidine]-2',4'-dione |
| SMILES | CN1CCN2c3ccc([N+](=O)[O-])cc3C[C@@]3(C(=O)CC(=S)NC3=O)C2C1 |
| InChI | InChI=1S/C17H18N4O4S/c1-19-4-5-20-12-3-2-11(21(24)25)6-10(12)8-17(13(20)9-19)14(22)7-15(26)18-16(17)23/h2-3,6,13H,4-5,7-9H2,1H3,(H,18,23,26)/t13?,17-/m0/s1 |
| InChIKey | WSTDQAPIIKMXSR-RUINGEJQSA-N |
| XLogP | 0.67 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|