C18H20N4O5 — CID 4917206
1',3-dimethyl-8-nitrospiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 4917206) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 1',3-dimethyl-8-nitrospiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | 1',3-dimethyl-8-nitrospiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 4917206 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1',3-dimethyl-8-nitrospiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | CC1CCN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)NC(=O)N(C)C3=O)C2C1 |
| InChI | InChI=1S/C18H20N4O5/c1-10-5-6-21-13-4-3-12(22(26)27)8-11(13)9-18(14(21)7-10)15(23)19-17(25)20(2)16(18)24/h3-4,8,10,14H,5-7,9H2,1-2H3,(H,19,23,25) |
| InChIKey | ZXGOGWPONWULQX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|