C20H22N4O4S — CID 124774491
(3R,4aR,5S)-1'-cyclopropyl-3-methyl-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione (PubChem CID 124774491) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is (3R,4aR,5S)-1'-cyclopropyl-3-methyl-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione.
| Compound Name | (3R,4aR,5S)-1'-cyclopropyl-3-methyl-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione |
|---|---|
| PubChem CID | 124774491 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (3R,4aR,5S)-1'-cyclopropyl-3-methyl-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione |
| SMILES | C[C@@H]1CCN2c3ccc([N+](=O)[O-])cc3C[C@@]3(C(=O)NC(=S)N(C4CC4)C3=O)[C@H]2C1 |
| InChI | InChI=1S/C20H22N4O4S/c1-11-6-7-22-15-5-4-14(24(27)28)9-12(15)10-20(16(22)8-11)17(25)21-19(29)23(18(20)26)13-2-3-13/h4-5,9,11,13,16H,2-3,6-8,10H2,1H3,(H,21,25,29)/t11-,16-,20+/m1/s1 |
| InChIKey | FOKAVCWXEQFMQC-GAFLKWJRSA-N |
| XLogP | 2.15 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|