C20H24N4O4S — CID 11921603
(4aR,5S)-1'-[(2S)-butan-2-yl]-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione (PubChem CID 11921603) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is (4aR,5S)-1'-[(2S)-butan-2-yl]-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione.
| Compound Name | (4aR,5S)-1'-[(2S)-butan-2-yl]-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione |
|---|---|
| PubChem CID | 11921603 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (4aR,5S)-1'-[(2S)-butan-2-yl]-8-nitro-2'-sulfanylidenespiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-4',6'-dione |
| SMILES | CC[C@H](C)N1C(=O)[C@]2(Cc3cc([N+](=O)[O-])ccc3N3CCCC[C@@H]32)C(=O)NC1=S |
| InChI | InChI=1S/C20H24N4O4S/c1-3-12(2)23-18(26)20(17(25)21-19(23)29)11-13-10-14(24(27)28)7-8-15(13)22-9-5-4-6-16(20)22/h7-8,10,12,16H,3-6,9,11H2,1-2H3,(H,21,25,29)/t12-,16+,20-/m0/s1 |
| InChIKey | LKTGDKWMAZNANQ-KRYHZZBUSA-N |
| XLogP | 2.54 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|