C23H21ClN4O4S — CID 40986226
(5R,6'aR)-1-(2-chlorophenyl)-3'-nitro-2-sulfanylidenespiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-4,6-dione (PubChem CID 40986226) has the molecular formula C23H21ClN4O4S and a molecular weight of 484.97 g/mol. Its IUPAC name is (5R,6'aR)-1-(2-chlorophenyl)-3'-nitro-2-sulfanylidenespiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-4,6-dione.
| Compound Name | (5R,6'aR)-1-(2-chlorophenyl)-3'-nitro-2-sulfanylidenespiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-4,6-dione |
|---|---|
| PubChem CID | 40986226 |
| Molecular Formula | C23H21ClN4O4S |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (5R,6'aR)-1-(2-chlorophenyl)-3'-nitro-2-sulfanylidenespiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2Cl)C(=O)[C@@]12Cc1cc([N+](=O)[O-])ccc1N1CCCCC[C@@H]12 |
| InChI | InChI=1S/C23H21ClN4O4S/c24-16-6-3-4-7-18(16)27-21(30)23(20(29)25-22(27)33)13-14-12-15(28(31)32)9-10-17(14)26-11-5-1-2-8-19(23)26/h3-4,6-7,9-10,12,19H,1-2,5,8,11,13H2,(H,25,29,33)/t19-,23-/m1/s1 |
| InChIKey | SGHRLOKZQMRVFJ-AUSIDOKSSA-N |
| XLogP | 3.99 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|