C23H23N5O5 — CID 4886382
3'-(2,3-dimethylphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4886382) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3'-(2,3-dimethylphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 3'-(2,3-dimethylphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4886382 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3'-(2,3-dimethylphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | Cc1cccc(N2CCN3c4ccc([N+](=O)[O-])cc4CC4(C(=O)NC(=O)NC4=O)C3C2)c1C |
| InChI | InChI=1S/C23H23N5O5/c1-13-4-3-5-17(14(13)2)26-8-9-27-18-7-6-16(28(32)33)10-15(18)11-23(19(27)12-26)20(29)24-22(31)25-21(23)30/h3-7,10,19H,8-9,11-12H2,1-2H3,(H2,24,25,29,30,31) |
| InChIKey | KBIBAPSUHHWJRS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|