C21H19N5O7S — CID 5305889
3'-(benzenesulfonyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 5305889) has the molecular formula C21H19N5O7S and a molecular weight of 485.48 g/mol. Its IUPAC name is 3'-(benzenesulfonyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 3'-(benzenesulfonyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 5305889 |
| Molecular Formula | C21H19N5O7S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3'-(benzenesulfonyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | O=C1NC(=O)C2(Cc3cc([N+](=O)[O-])ccc3N3CCN(S(=O)(=O)c4ccccc4)CC32)C(=O)N1 |
| InChI | InChI=1S/C21H19N5O7S/c27-18-21(19(28)23-20(29)22-18)11-13-10-14(26(30)31)6-7-16(13)25-9-8-24(12-17(21)25)34(32,33)15-4-2-1-3-5-15/h1-7,10,17H,8-9,11-12H2,(H2,22,23,27,28,29) |
| InChIKey | FZRIPNBNGDOHIC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|