C25H20FN7O5 — CID 100863493
(4'aR,5S)-1-(4-fluorophenyl)-8'-nitro-3'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 100863493) has the molecular formula C25H20FN7O5 and a molecular weight of 517.48 g/mol. Its IUPAC name is (4'aR,5S)-1-(4-fluorophenyl)-8'-nitro-3'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-1-(4-fluorophenyl)-8'-nitro-3'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100863493 |
| Molecular Formula | C25H20FN7O5 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (4'aR,5S)-1-(4-fluorophenyl)-8'-nitro-3'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | O=C1NC(=O)[C@@]2(Cc3cc([N+](=O)[O-])ccc3N3CCN(c4ncccn4)C[C@H]32)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20FN7O5/c26-16-2-4-17(5-3-16)32-22(35)25(21(34)29-24(32)36)13-15-12-18(33(37)38)6-7-19(15)31-11-10-30(14-20(25)31)23-27-8-1-9-28-23/h1-9,12,20H,10-11,13-14H2,(H,29,34,36)/t20-,25-/m0/s1 |
| InChIKey | JBWXWSGRQSHLLH-CPJSRVTESA-N |
| XLogP | 2.04 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|