C23H20ClN5O6 — CID 26314023
(3R,4aS,5S)-1'-(4-chlorophenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxamide (PubChem CID 26314023) has the molecular formula C23H20ClN5O6 and a molecular weight of 497.90 g/mol. Its IUPAC name is (3R,4aS,5S)-1'-(4-chlorophenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxamide.
| Compound Name | (3R,4aS,5S)-1'-(4-chlorophenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxamide |
|---|---|
| PubChem CID | 26314023 |
| Molecular Formula | C23H20ClN5O6 |
| Molecular Weight | 497.90 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (3R,4aS,5S)-1'-(4-chlorophenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCN2c3ccc([N+](=O)[O-])cc3C[C@@]3(C(=O)NC(=O)N(c4ccc(Cl)cc4)C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H20ClN5O6/c24-14-1-3-15(4-2-14)28-21(32)23(20(31)26-22(28)33)11-13-9-16(29(34)35)5-6-17(13)27-8-7-12(19(25)30)10-18(23)27/h1-6,9,12,18H,7-8,10-11H2,(H2,25,30)(H,26,31,33)/t12-,18+,23+/m1/s1 |
| InChIKey | KVVYMIKSWPHUSH-DFFZLKDPSA-N |
| XLogP | 2.14 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|