C26H26N4O8 — CID 40978022
ethyl (3S,4aS,5R)-1'-(4-methoxyphenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate (PubChem CID 40978022) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is ethyl (3S,4aS,5R)-1'-(4-methoxyphenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate.
| Compound Name | ethyl (3S,4aS,5R)-1'-(4-methoxyphenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate |
|---|---|
| PubChem CID | 40978022 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | ethyl (3S,4aS,5R)-1'-(4-methoxyphenyl)-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCN2c3ccc([N+](=O)[O-])cc3C[C@]3(C(=O)NC(=O)N(c4ccc(OC)cc4)C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C26H26N4O8/c1-3-38-22(31)15-10-11-28-20-9-6-18(30(35)36)12-16(20)14-26(21(28)13-15)23(32)27-25(34)29(24(26)33)17-4-7-19(37-2)8-5-17/h4-9,12,15,21H,3,10-11,13-14H2,1-2H3,(H,27,32,34)/t15-,21-,26+/m0/s1 |
| InChIKey | HCHDLSARMLLYRF-KCMSVQPVSA-N |
| XLogP | 2.58 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|