C26H20N4O6 — CID 100890281
(5S,6'aS)-1-(4-methoxyphenyl)-3'-nitrospiro[1,3-diazinane-5,6'-6a,11-dihydro-5H-isoindolo[2,1-a]quinoline]-2,4,6-trione (PubChem CID 100890281) has the molecular formula C26H20N4O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is (5S,6'aS)-1-(4-methoxyphenyl)-3'-nitrospiro[1,3-diazinane-5,6'-6a,11-dihydro-5H-isoindolo[2,1-a]quinoline]-2,4,6-trione.
| Compound Name | (5S,6'aS)-1-(4-methoxyphenyl)-3'-nitrospiro[1,3-diazinane-5,6'-6a,11-dihydro-5H-isoindolo[2,1-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100890281 |
| Molecular Formula | C26H20N4O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (5S,6'aS)-1-(4-methoxyphenyl)-3'-nitrospiro[1,3-diazinane-5,6'-6a,11-dihydro-5H-isoindolo[2,1-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)[C@@]3(Cc4cc([N+](=O)[O-])ccc4N4Cc5ccccc5[C@H]43)C2=O)cc1 |
| InChI | InChI=1S/C26H20N4O6/c1-36-19-9-6-17(7-10-19)29-24(32)26(23(31)27-25(29)33)13-16-12-18(30(34)35)8-11-21(16)28-14-15-4-2-3-5-20(15)22(26)28/h2-12,22H,13-14H2,1H3,(H,27,31,33)/t22-,26-/m0/s1 |
| InChIKey | TXPZSXRWIJIRNS-NVQXNPDNSA-N |
| XLogP | 3.49 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|