C29H27N5O6 — CID 100889878
(4'aR,5S)-3'-benzyl-1-(4-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 100889878) has the molecular formula C29H27N5O6 and a molecular weight of 541.56 g/mol. Its IUPAC name is (4'aR,5S)-3'-benzyl-1-(4-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-3'-benzyl-1-(4-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100889878 |
| Molecular Formula | C29H27N5O6 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (4'aR,5S)-3'-benzyl-1-(4-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)[C@@]3(Cc4cc([N+](=O)[O-])ccc4N4CCN(Cc5ccccc5)C[C@H]43)C2=O)cc1 |
| InChI | InChI=1S/C29H27N5O6/c1-40-23-10-7-21(8-11-23)33-27(36)29(26(35)30-28(33)37)16-20-15-22(34(38)39)9-12-24(20)32-14-13-31(18-25(29)32)17-19-5-3-2-4-6-19/h2-12,15,25H,13-14,16-18H2,1H3,(H,30,35,37)/t25-,29-/m0/s1 |
| InChIKey | WZRZQGAKQAARFH-SVEHJYQDSA-N |
| XLogP | 3.12 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|