C24H22ClN5O7 — CID 4899567
ethyl 1-(4-chlorophenyl)-8'-nitro-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-3'-carboxylate (PubChem CID 4899567) has the molecular formula C24H22ClN5O7 and a molecular weight of 527.92 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-8'-nitro-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-3'-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)-8'-nitro-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 4899567 |
| Molecular Formula | C24H22ClN5O7 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-8'-nitro-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-3'-carboxylate |
| SMILES | CCOC(=O)N1CCN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)NC(=O)N(c4ccc(Cl)cc4)C3=O)C2C1 |
| InChI | InChI=1S/C24H22ClN5O7/c1-2-37-23(34)27-9-10-28-18-8-7-17(30(35)36)11-14(18)12-24(19(28)13-27)20(31)26-22(33)29(21(24)32)16-5-3-15(25)4-6-16/h3-8,11,19H,2,9-10,12-13H2,1H3,(H,26,31,33) |
| InChIKey | WJAOEJLUKWIAFO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|