C21H24N4O7 — CID 4891330
ethyl 1',3'-dimethyl-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate (PubChem CID 4891330) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl 1',3'-dimethyl-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate.
| Compound Name | ethyl 1',3'-dimethyl-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate |
|---|---|
| PubChem CID | 4891330 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | ethyl 1',3'-dimethyl-8-nitro-2',4',6'-trioxospiro[1,2,3,4,4a,6-hexahydrobenzo[f]quinolizine-5,5'-1,3-diazinane]-3-carboxylate |
| SMILES | CCOC(=O)C1CCN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)N(C)C(=O)N(C)C3=O)C2C1 |
| InChI | InChI=1S/C21H24N4O7/c1-4-32-17(26)12-7-8-24-15-6-5-14(25(30)31)9-13(15)11-21(16(24)10-12)18(27)22(2)20(29)23(3)19(21)28/h5-6,9,12,16H,4,7-8,10-11H2,1-3H3 |
| InChIKey | ZZFVAGOYJLLTHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|