C19H21N5O6 — CID 40905833
(4'aR)-3'-acetyl-1,3-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 40905833) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is (4'aR)-3'-acetyl-1,3-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR)-3'-acetyl-1,3-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 40905833 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (4'aR)-3'-acetyl-1,3-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CC(=O)N1CCN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)N(C)C(=O)N(C)C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H21N5O6/c1-11(25)22-6-7-23-14-5-4-13(24(29)30)8-12(14)9-19(15(23)10-22)16(26)20(2)18(28)21(3)17(19)27/h4-5,8,15H,6-7,9-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | KXVQUWMBYVDCRO-HNNXBMFYSA-N |
| XLogP | 0.22 |
| TPSA | 124.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|